C27H24F3N7O4 — CID 135306740
1-[[3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea (PubChem CID 135306740) has the molecular formula C27H24F3N7O4 and a molecular weight of 567.53 g/mol. Its IUPAC name is 1-[[3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea.
| Compound Name | 1-[[3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea |
|---|---|
| PubChem CID | 135306740 |
| Molecular Formula | C27H24F3N7O4 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.18 |
| IUPAC Name | 1-[[3-morpholin-4-yl-5-(trifluoromethyl)pyridine-2-carbonyl]amino]-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)urea |
| SMILES | O=C(NNC(=O)c1ncc(C(F)(F)F)cc1N1CCOCC1)NC1N=C(c2ccccc2)c2ccccc2NC1=O |
| InChI | InChI=1S/C27H24F3N7O4/c28-27(29,30)17-14-20(37-10-12-41-13-11-37)22(31-15-17)24(38)35-36-26(40)34-23-25(39)32-19-9-5-4-8-18(19)21(33-23)16-6-2-1-3-7-16/h1-9,14-15,23H,10-13H2,(H,32,39)(H,35,38)(H2,34,36,40) |
| InChIKey | GDORULVUIYHQOW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|