C22H23N5O3S — CID 134461207
1-(oxane-4-carbonylamino)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)thiourea (PubChem CID 134461207) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 1-(oxane-4-carbonylamino)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)thiourea.
| Compound Name | 1-(oxane-4-carbonylamino)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)thiourea |
|---|---|
| PubChem CID | 134461207 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 1-(oxane-4-carbonylamino)-3-(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl)thiourea |
| SMILES | O=C(NNC(=S)NC1N=C(c2ccccc2)c2ccccc2NC1=O)C1CCOCC1 |
| InChI | InChI=1S/C22H23N5O3S/c28-20(15-10-12-30-13-11-15)26-27-22(31)25-19-21(29)23-17-9-5-4-8-16(17)18(24-19)14-6-2-1-3-7-14/h1-9,15,19H,10-13H2,(H,23,29)(H,26,28)(H2,25,27,31) |
| InChIKey | XZUMZOJLQLBSLN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|