C18H10Cl3F3N4 — CID 2768805
2,4-dichloro-N-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-pyridin-3-ylmethylidene]amino]aniline (PubChem CID 2768805) has the molecular formula C18H10Cl3F3N4 and a molecular weight of 445.66 g/mol. Its IUPAC name is 2,4-dichloro-N-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-pyridin-3-ylmethylidene]amino]aniline.
| Compound Name | 2,4-dichloro-N-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-pyridin-3-ylmethylidene]amino]aniline |
|---|---|
| PubChem CID | 2768805 |
| Molecular Formula | C18H10Cl3F3N4 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | 2,4-dichloro-N-[[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-pyridin-3-ylmethylidene]amino]aniline |
| SMILES | FC(F)(F)c1cnc(C(=NNc2ccc(Cl)cc2Cl)c2cccnc2)c(Cl)c1 |
| InChI | InChI=1S/C18H10Cl3F3N4/c19-12-3-4-15(13(20)7-12)27-28-16(10-2-1-5-25-8-10)17-14(21)6-11(9-26-17)18(22,23)24/h1-9,27H |
| InChIKey | SWDOARVFIHAZIE-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|