N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride

C8H7Cl3N2 — CID 72815031

IUPACN-(2,4-dichlorophenyl)ethanehydrazonoyl chloride
SMILESCC(Cl)=NNc1ccc(Cl)cc1Cl
InChIInChI=1S/C8H7Cl3N2/c1-5(9)12-13-8-3-2-6(10)4-7(8)11/h2-4,13H,1H3
InChIKeyWQVCFOZKNFKVMJ-UHFFFAOYSA-N
MW237.52 g/mol
LogP3.98
Rot. Bonds2

About N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride

N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride (PubChem CID 72815031) has the molecular formula C8H7Cl3N2 and a molecular weight of 237.52 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride.

Molecular Properties

Compound NameN-(2,4-dichlorophenyl)ethanehydrazonoyl chloride
PubChem CID72815031
Molecular FormulaC8H7Cl3N2
Molecular Weight237.52 g/mol
Exact Mass235.97
IUPAC NameN-(2,4-dichlorophenyl)ethanehydrazonoyl chloride
SMILESCC(Cl)=NNc1ccc(Cl)cc1Cl
InChIInChI=1S/C8H7Cl3N2/c1-5(9)12-13-8-3-2-6(10)4-7(8)11/h2-4,13H,1H3
InChIKeyWQVCFOZKNFKVMJ-UHFFFAOYSA-N
XLogP3.98
TPSA24.39 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.52
LogP ≤ 53.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride?
The IUPAC name of N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride (CID 72815031) is N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride.
What is the SMILES notation for N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride?
The canonical SMILES for N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride is CC(Cl)=NNc1ccc(Cl)cc1Cl.
What is the InChIKey of N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride?
The InChIKey is WQVCFOZKNFKVMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl3N2/c1-5(9)12-13-8-3-2-6(10)4-7(8)11/h2-4,13H,1H3.
What are the key properties of N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride?
N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride has a molecular weight of 237.52 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dichlorophenyl)ethanehydrazonoyl chloride is sourced from PubChem (CID 72815031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).