C11H9Cl2F3N2O2 — CID 134106161
ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3,3,3-trifluoropropanoate (PubChem CID 134106161) has the molecular formula C11H9Cl2F3N2O2 and a molecular weight of 329.11 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3,3,3-trifluoropropanoate.
| Compound Name | ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 134106161 |
| Molecular Formula | C11H9Cl2F3N2O2 |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3,3,3-trifluoropropanoate |
| SMILES | CCOC(=O)/C(=N/Nc1ccc(Cl)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C11H9Cl2F3N2O2/c1-2-20-10(19)9(11(14,15)16)18-17-8-4-3-6(12)5-7(8)13/h3-5,17H,2H2,1H3/b18-9- |
| InChIKey | QIFKYQRNJUYAQC-NVMNQCDNSA-N |
| XLogP | 3.89 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|