C19H17BrCl2N2O3 — CID 10600492
ethyl (2E)-4-(4-bromophenyl)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-4-oxobutanoate (PubChem CID 10600492) has the molecular formula C19H17BrCl2N2O3 and a molecular weight of 472.17 g/mol. Its IUPAC name is ethyl (2E)-4-(4-bromophenyl)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-4-oxobutanoate.
| Compound Name | ethyl (2E)-4-(4-bromophenyl)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 10600492 |
| Molecular Formula | C19H17BrCl2N2O3 |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 469.98 |
| IUPAC Name | ethyl (2E)-4-(4-bromophenyl)-2-[(2,4-dichlorophenyl)hydrazinylidene]-3-methyl-4-oxobutanoate |
| SMILES | CCOC(=O)/C(=N/Nc1ccc(Cl)cc1Cl)C(C)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrCl2N2O3/c1-3-27-19(26)17(24-23-16-9-8-14(21)10-15(16)22)11(2)18(25)12-4-6-13(20)7-5-12/h4-11,23H,3H2,1-2H3/b24-17+ |
| InChIKey | SQNGJAUHOJDVIE-JJIBRWJFSA-N |
| XLogP | 5.61 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|