C12H14Cl2N2O2 — CID 12858861
ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate (PubChem CID 12858861) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate.
| Compound Name | ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate |
|---|---|
| PubChem CID | 12858861 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | ethyl (2Z)-2-[(2,4-dichlorophenyl)hydrazinylidene]butanoate |
| SMILES | CCOC(=O)/C(CC)=N\Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-3-10(12(17)18-4-2)15-16-11-6-5-8(13)7-9(11)14/h5-7,16H,3-4H2,1-2H3/b15-10- |
| InChIKey | ZKZGEBZWCRCCSG-GDNBJRDFSA-N |
| XLogP | 3.73 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|