C22H24Cl2N4O4 — CID 177479961
ethyl (2E)-2-[[2-chloro-4-[3-chloro-4-[(2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]propanoate (PubChem CID 177479961) has the molecular formula C22H24Cl2N4O4 and a molecular weight of 479.36 g/mol. Its IUPAC name is ethyl (2E)-2-[[2-chloro-4-[3-chloro-4-[(2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]propanoate.
| Compound Name | ethyl (2E)-2-[[2-chloro-4-[3-chloro-4-[(2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 177479961 |
| Molecular Formula | C22H24Cl2N4O4 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | ethyl (2E)-2-[[2-chloro-4-[3-chloro-4-[(2E)-2-(1-ethoxy-1-oxopropan-2-ylidene)hydrazinyl]phenyl]phenyl]hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N/Nc1ccc(-c2ccc(N/N=C(\C)C(=O)OCC)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C22H24Cl2N4O4/c1-5-31-21(29)13(3)25-27-19-9-7-15(11-17(19)23)16-8-10-20(18(24)12-16)28-26-14(4)22(30)32-6-2/h7-12,27-28H,5-6H2,1-4H3/b25-13+,26-14+ |
| InChIKey | QVZABTZNKHKTNZ-BKHCZYBLSA-N |
| XLogP | 5.36 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|