C11H11BrF2N2O2 — CID 140687018
ethyl (2Z)-2-[(2-bromo-3,4-difluorophenyl)hydrazinylidene]propanoate (PubChem CID 140687018) has the molecular formula C11H11BrF2N2O2 and a molecular weight of 321.12 g/mol. Its IUPAC name is ethyl (2Z)-2-[(2-bromo-3,4-difluorophenyl)hydrazinylidene]propanoate.
| Compound Name | ethyl (2Z)-2-[(2-bromo-3,4-difluorophenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 140687018 |
| Molecular Formula | C11H11BrF2N2O2 |
| Molecular Weight | 321.12 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | ethyl (2Z)-2-[(2-bromo-3,4-difluorophenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N\Nc1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C11H11BrF2N2O2/c1-3-18-11(17)6(2)15-16-8-5-4-7(13)10(14)9(8)12/h4-5,16H,3H2,1-2H3/b15-6- |
| InChIKey | ZTNCNOXKAYEIIW-UUASQNMZSA-N |
| XLogP | 3.08 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.12 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|