C15H22N2O2 — CID 5377178
ethyl (2E)-2-[(4-tert-butylphenyl)hydrazinylidene]propanoate (PubChem CID 5377178) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl (2E)-2-[(4-tert-butylphenyl)hydrazinylidene]propanoate.
| Compound Name | ethyl (2E)-2-[(4-tert-butylphenyl)hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 5377178 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethyl (2E)-2-[(4-tert-butylphenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N/Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22N2O2/c1-6-19-14(18)11(2)16-17-13-9-7-12(8-10-13)15(3,4)5/h7-10,17H,6H2,1-5H3/b16-11+ |
| InChIKey | OMEJRDAUYRQCRR-LFIBNONCSA-N |
| XLogP | 3.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|