C23H25N3O3 — CID 42108517
ethyl (2Z)-2-[[4-[(1S)-1-cyano-3-methyl-2-oxo-1-phenylbutyl]phenyl]hydrazinylidene]propanoate (PubChem CID 42108517) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl (2Z)-2-[[4-[(1S)-1-cyano-3-methyl-2-oxo-1-phenylbutyl]phenyl]hydrazinylidene]propanoate.
| Compound Name | ethyl (2Z)-2-[[4-[(1S)-1-cyano-3-methyl-2-oxo-1-phenylbutyl]phenyl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 42108517 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | ethyl (2Z)-2-[[4-[(1S)-1-cyano-3-methyl-2-oxo-1-phenylbutyl]phenyl]hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N\Nc1ccc([C@@](C#N)(C(=O)C(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-5-29-22(28)17(4)25-26-20-13-11-19(12-14-20)23(15-24,21(27)16(2)3)18-9-7-6-8-10-18/h6-14,16,26H,5H2,1-4H3/b25-17-/t23-/m0/s1 |
| InChIKey | SWXWVEIYKMQZOL-XQGNUGGCSA-N |
| XLogP | 4.07 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|