C20H18F6N2O3 — CID 88796860
ethyl (2Z)-2-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]hydrazinylidene]-3-phenylpropanoate (PubChem CID 88796860) has the molecular formula C20H18F6N2O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is ethyl (2Z)-2-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]hydrazinylidene]-3-phenylpropanoate.
| Compound Name | ethyl (2Z)-2-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]hydrazinylidene]-3-phenylpropanoate |
|---|---|
| PubChem CID | 88796860 |
| Molecular Formula | C20H18F6N2O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | ethyl (2Z)-2-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]hydrazinylidene]-3-phenylpropanoate |
| SMILES | CCOC(=O)/C(Cc1ccccc1)=N\Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F6N2O3/c1-2-31-17(29)16(12-13-6-4-3-5-7-13)28-27-15-10-8-14(9-11-15)18(30,19(21,22)23)20(24,25)26/h3-11,27,30H,2,12H2,1H3/b28-16- |
| InChIKey | WOWXMNZIBSAWLF-NTFVMDSBSA-N |
| XLogP | 4.57 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|