C11H10ClF3N2O2 — CID 2761310
ethyl 2-chloro-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]acetate (PubChem CID 2761310) has the molecular formula C11H10ClF3N2O2 and a molecular weight of 294.66 g/mol. Its IUPAC name is ethyl 2-chloro-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]acetate.
| Compound Name | ethyl 2-chloro-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 2761310 |
| Molecular Formula | C11H10ClF3N2O2 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | ethyl 2-chloro-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)C(Cl)=NNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10ClF3N2O2/c1-2-19-10(18)9(12)17-16-8-5-3-4-7(6-8)11(13,14)15/h3-6,16H,2H2,1H3 |
| InChIKey | HXRVSIPGGUOVJA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|