C21H28F3N3O2 — CID 6264442
ethyl (2E)-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)acetate (PubChem CID 6264442) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is ethyl (2E)-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)acetate.
| Compound Name | ethyl (2E)-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)acetate |
|---|---|
| PubChem CID | 6264442 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | ethyl (2E)-2-[[3-(trifluoromethyl)phenyl]hydrazinylidene]-2-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)acetate |
| SMILES | CCOC(=O)/C(=N\Nc1cccc(C(F)(F)F)c1)N1CC2(C)CC1CC(C)(C)C2 |
| InChI | InChI=1S/C21H28F3N3O2/c1-5-29-18(28)17(26-25-15-8-6-7-14(9-15)21(22,23)24)27-13-20(4)11-16(27)10-19(2,3)12-20/h6-9,16,25H,5,10-13H2,1-4H3/b26-17+ |
| InChIKey | MGVMLFDIOQVANU-YZSQISJMSA-N |
| XLogP | 4.89 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|