C10H9ClF2N2O2 — CID 59664793
ethyl (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetate (PubChem CID 59664793) has the molecular formula C10H9ClF2N2O2 and a molecular weight of 262.64 g/mol. Its IUPAC name is ethyl (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetate.
| Compound Name | ethyl (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetate |
|---|---|
| PubChem CID | 59664793 |
| Molecular Formula | C10H9ClF2N2O2 |
| Molecular Weight | 262.64 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | ethyl (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(Cl)=N/Nc1cc(F)ccc1F |
| InChI | InChI=1S/C10H9ClF2N2O2/c1-2-17-10(16)9(11)15-14-8-5-6(12)3-4-7(8)13/h3-5,14H,2H2,1H3/b15-9- |
| InChIKey | KDGDTKSZZQIFNS-DHDCSXOGSA-N |
| XLogP | 2.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.64 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|