C8H5ClF2N2O2 — CID 87771572
(2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetic acid (PubChem CID 87771572) has the molecular formula C8H5ClF2N2O2 and a molecular weight of 234.59 g/mol. Its IUPAC name is (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetic acid.
| Compound Name | (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetic acid |
|---|---|
| PubChem CID | 87771572 |
| Molecular Formula | C8H5ClF2N2O2 |
| Molecular Weight | 234.59 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | (2Z)-2-chloro-2-[(2,5-difluorophenyl)hydrazinylidene]acetic acid |
| SMILES | O=C(O)/C(Cl)=N/Nc1cc(F)ccc1F |
| InChI | InChI=1S/C8H5ClF2N2O2/c9-7(8(14)15)13-12-6-3-4(10)1-2-5(6)11/h1-3,12H,(H,14,15)/b13-7- |
| InChIKey | ZPUPKVDPMYSKCL-QPEQYQDCSA-N |
| XLogP | 2.01 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|