C9H8F2N2O2 — CID 21298987
(2Z)-2-[(2,4-difluorophenyl)hydrazinylidene]propanoic acid (PubChem CID 21298987) has the molecular formula C9H8F2N2O2 and a molecular weight of 214.17 g/mol. Its IUPAC name is (2Z)-2-[(2,4-difluorophenyl)hydrazinylidene]propanoic acid.
| Compound Name | (2Z)-2-[(2,4-difluorophenyl)hydrazinylidene]propanoic acid |
|---|---|
| PubChem CID | 21298987 |
| Molecular Formula | C9H8F2N2O2 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2Z)-2-[(2,4-difluorophenyl)hydrazinylidene]propanoic acid |
| SMILES | C/C(=N/Nc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C9H8F2N2O2/c1-5(9(14)15)12-13-8-3-2-6(10)4-7(8)11/h2-4,13H,1H3,(H,14,15)/b12-5- |
| InChIKey | UXZLHCVEHFXLDT-XGICHPGQSA-N |
| XLogP | 1.84 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|