C16H12F2N2O3S — CID 46259255
2-[(Z)-C-acetyl-N-(2,4-difluoroanilino)carbonimidoyl]sulfanylbenzoic acid (PubChem CID 46259255) has the molecular formula C16H12F2N2O3S and a molecular weight of 350.35 g/mol. Its IUPAC name is 2-[(Z)-C-acetyl-N-(2,4-difluoroanilino)carbonimidoyl]sulfanylbenzoic acid.
| Compound Name | 2-[(Z)-C-acetyl-N-(2,4-difluoroanilino)carbonimidoyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 46259255 |
| Molecular Formula | C16H12F2N2O3S |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-[(Z)-C-acetyl-N-(2,4-difluoroanilino)carbonimidoyl]sulfanylbenzoic acid |
| SMILES | CC(=O)/C(=N/Nc1ccc(F)cc1F)Sc1ccccc1C(=O)O |
| InChI | InChI=1S/C16H12F2N2O3S/c1-9(21)15(20-19-13-7-6-10(17)8-12(13)18)24-14-5-3-2-4-11(14)16(22)23/h2-8,19H,1H3,(H,22,23)/b20-15- |
| InChIKey | DBDOLMLROLFCHZ-HKWRFOASSA-N |
| XLogP | 3.77 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|