C16H15F2N2O3- — CID 9390750
3-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate (PubChem CID 9390750) has the molecular formula C16H15F2N2O3- and a molecular weight of 321.30 g/mol. Its IUPAC name is 3-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate.
| Compound Name | 3-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
|---|---|
| PubChem CID | 9390750 |
| Molecular Formula | C16H15F2N2O3- |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3-[4-[(Z)-N-(2,4-difluoroanilino)-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
| SMILES | C/C(=N/Nc1ccc(F)cc1F)c1cc(CCC(=O)[O-])oc1C |
| InChI | InChI=1S/C16H16F2N2O3/c1-9(19-20-15-5-3-11(17)7-14(15)18)13-8-12(23-10(13)2)4-6-16(21)22/h3,5,7-8,20H,4,6H2,1-2H3,(H,21,22)/p-1/b19-9- |
| InChIKey | RUNBZSODUCWFSB-OCKHKDLRSA-M |
| XLogP | 2.38 |
| TPSA | 77.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|