C17H18FN3O3S — CID 9392400
3-[4-[(Z)-N-[(4-fluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid (PubChem CID 9392400) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[4-[(Z)-N-[(4-fluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-N-[(4-fluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid |
|---|---|
| PubChem CID | 9392400 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 3-[4-[(Z)-N-[(4-fluorophenyl)carbamothioylamino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid |
| SMILES | C/C(=N/NC(=S)Nc1ccc(F)cc1)c1cc(CCC(=O)O)oc1C |
| InChI | InChI=1S/C17H18FN3O3S/c1-10(15-9-14(24-11(15)2)7-8-16(22)23)20-21-17(25)19-13-5-3-12(18)4-6-13/h3-6,9H,7-8H2,1-2H3,(H,22,23)(H2,19,21,25)/b20-10- |
| InChIKey | ZCLQPSVVVKFTAA-JMIUGGIZSA-N |
| XLogP | 3.45 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_J(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|