C15H21N3O5 — CID 9397894
3-[5-methyl-4-[(Z)-C-methyl-N-[[2-oxo-2-(propan-2-ylamino)acetyl]amino]carbonimidoyl]furan-2-yl]propanoic acid (PubChem CID 9397894) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[5-methyl-4-[(Z)-C-methyl-N-[[2-oxo-2-(propan-2-ylamino)acetyl]amino]carbonimidoyl]furan-2-yl]propanoic acid.
| Compound Name | 3-[5-methyl-4-[(Z)-C-methyl-N-[[2-oxo-2-(propan-2-ylamino)acetyl]amino]carbonimidoyl]furan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 9397894 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-[5-methyl-4-[(Z)-C-methyl-N-[[2-oxo-2-(propan-2-ylamino)acetyl]amino]carbonimidoyl]furan-2-yl]propanoic acid |
| SMILES | C/C(=N/NC(=O)C(=O)NC(C)C)c1cc(CCC(=O)O)oc1C |
| InChI | InChI=1S/C15H21N3O5/c1-8(2)16-14(21)15(22)18-17-9(3)12-7-11(23-10(12)4)5-6-13(19)20/h7-8H,5-6H2,1-4H3,(H,16,21)(H,18,22)(H,19,20)/b17-9- |
| InChIKey | BLOWCEUIFVCVHA-MFOYZWKCSA-N |
| XLogP | 0.97 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|