About 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid
3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid (PubChem CID 9394998) has the molecular formula C17H16Cl2N2O4
and a molecular weight of 383.23 g/mol. Its IUPAC name is 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid |
| PubChem CID | 9394998 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid |
| SMILES | C/C(=N/NC(=O)c1cc(Cl)ccc1Cl)c1cc(CCC(=O)O)oc1C |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-9(13-8-12(25-10(13)2)4-6-16(22)23)20-21-17(24)14-7-11(18)3-5-15(14)19/h3,5,7-8H,4,6H2,1-2H3,(H,21,24)(H,22,23)/b20-9- |
| InChIKey | YTRFDYBLFUJYDP-UKWGHVSLSA-N |
| XLogP | 4.07 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid?
The IUPAC name of 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid (CID 9394998) is 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid.
What is the SMILES notation for 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid?
The canonical SMILES for 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid is C/C(=N/NC(=O)c1cc(Cl)ccc1Cl)c1cc(CCC(=O)O)oc1C.
What is the InChIKey of 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid?
The InChIKey is YTRFDYBLFUJYDP-UKWGHVSLSA-N. The full InChI is InChI=1S/C17H16Cl2N2O4/c1-9(13-8-12(25-10(13)2)4-6-16(22)23)20-21-17(24)14-7-11(18)3-5-15(14)19/h3,5,7-8H,4,6H2,1-2H3,(H,21,24)(H,22,23)/b20-9-.
What are the key properties of 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid?
3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid has a molecular weight of 383.23 g/mol, XLogP of 4.07, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(Z)-N-[(2,5-dichlorobenzoyl)amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid is sourced from PubChem (CID 9394998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).