C20H22N4O4S — CID 9398361
3-[4-[(Z)-N-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid (PubChem CID 9398361) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-[4-[(Z)-N-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid.
| Compound Name | 3-[4-[(Z)-N-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid |
|---|---|
| PubChem CID | 9398361 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-[4-[(Z)-N-[[(2S)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoic acid |
| SMILES | C/C(=N/NC(=O)[C@H](C)Nc1nc2ccccc2s1)c1cc(CCC(=O)O)oc1C |
| InChI | InChI=1S/C20H22N4O4S/c1-11(15-10-14(28-13(15)3)8-9-18(25)26)23-24-19(27)12(2)21-20-22-16-6-4-5-7-17(16)29-20/h4-7,10,12H,8-9H2,1-3H3,(H,21,22)(H,24,27)(H,25,26)/b23-11-/t12-/m0/s1 |
| InChIKey | LQBIDXSOLFGDQI-QNEYSMKTSA-N |
| XLogP | 3.56 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|