C18H23N3OS — CID 35708598
(2R)-2-(1,3-benzothiazol-2-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 35708598) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 35708598 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2R)-2-(1,3-benzothiazol-2-ylamino)-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | C[C@@H](Nc1nc2ccccc2s1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H23N3OS/c1-13(17(22)19-12-11-14-7-3-2-4-8-14)20-18-21-15-9-5-6-10-16(15)23-18/h5-7,9-10,13H,2-4,8,11-12H2,1H3,(H,19,22)(H,20,21)/t13-/m1/s1 |
| InChIKey | LATNFCAYPCNABE-CYBMUJFWSA-N |
| XLogP | 4.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|