C23H34N4OS+2 — CID 8693569
(2S)-2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide (PubChem CID 8693569) has the molecular formula C23H34N4OS+2 and a molecular weight of 414.62 g/mol. Its IUPAC name is (2S)-2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide.
| Compound Name | (2S)-2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 8693569 |
| Molecular Formula | C23H34N4OS+2 |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2S)-2-[4-(1,3-benzothiazol-2-ylmethyl)piperazine-1,4-diium-1-yl]-N-[2-(cyclohexen-1-yl)ethyl]propanamide |
| SMILES | C[C@@H](C(=O)NCCC1=CCCCC1)[NH+]1CC[NH+](Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C23H32N4OS/c1-18(23(28)24-12-11-19-7-3-2-4-8-19)27-15-13-26(14-16-27)17-22-25-20-9-5-6-10-21(20)29-22/h5-7,9-10,18H,2-4,8,11-17H2,1H3,(H,24,28)/p+2/t18-/m0/s1 |
| InChIKey | YPHWZTYNUYHLSP-SFHVURJKSA-P |
| XLogP | 0.97 |
| TPSA | 50.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|