C15H17N3O3S — CID 154801902
methyl (E)-4-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]but-2-enoate (PubChem CID 154801902) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is methyl (E)-4-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]but-2-enoate.
| Compound Name | methyl (E)-4-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]but-2-enoate |
|---|---|
| PubChem CID | 154801902 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl (E)-4-[2-(1,3-benzothiazol-2-ylamino)propanoylamino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C(C)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10(14(20)16-9-5-8-13(19)21-2)17-15-18-11-6-3-4-7-12(11)22-15/h3-8,10H,9H2,1-2H3,(H,16,20)(H,17,18)/b8-5+ |
| InChIKey | DDHVJOHFMLKMCS-VMPITWQZSA-N |
| XLogP | 1.94 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|