C20H21N4O4S- — CID 9398354
3-[4-[(Z)-N-[[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate (PubChem CID 9398354) has the molecular formula C20H21N4O4S- and a molecular weight of 413.48 g/mol. Its IUPAC name is 3-[4-[(Z)-N-[[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate.
| Compound Name | 3-[4-[(Z)-N-[[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
|---|---|
| PubChem CID | 9398354 |
| Molecular Formula | C20H21N4O4S- |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-[4-[(Z)-N-[[(2R)-2-(1,3-benzothiazol-2-ylamino)propanoyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
| SMILES | C/C(=N/NC(=O)[C@@H](C)Nc1nc2ccccc2s1)c1cc(CCC(=O)[O-])oc1C |
| InChI | InChI=1S/C20H22N4O4S/c1-11(15-10-14(28-13(15)3)8-9-18(25)26)23-24-19(27)12(2)21-20-22-16-6-4-5-7-17(16)29-20/h4-7,10,12H,8-9H2,1-3H3,(H,21,22)(H,24,27)(H,25,26)/p-1/b23-11-/t12-/m1/s1 |
| InChIKey | LQBIDXSOLFGDQI-RMJYUUNHSA-M |
| XLogP | 2.22 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|