C22H27N2O5- — CID 9391511
3-[4-[(Z)-N-[[2-(4-tert-butylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate (PubChem CID 9391511) has the molecular formula C22H27N2O5- and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[4-[(Z)-N-[[2-(4-tert-butylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate.
| Compound Name | 3-[4-[(Z)-N-[[2-(4-tert-butylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
|---|---|
| PubChem CID | 9391511 |
| Molecular Formula | C22H27N2O5- |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-[4-[(Z)-N-[[2-(4-tert-butylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
| SMILES | C/C(=N/NC(=O)COc1ccc(C(C)(C)C)cc1)c1cc(CCC(=O)[O-])oc1C |
| InChI | InChI=1S/C22H28N2O5/c1-14(19-12-18(29-15(19)2)10-11-21(26)27)23-24-20(25)13-28-17-8-6-16(7-9-17)22(3,4)5/h6-9,12H,10-11,13H2,1-5H3,(H,24,25)(H,26,27)/p-1/b23-14- |
| InChIKey | DPGJVUMHRKZHOK-UCQKPKSFSA-M |
| XLogP | 2.49 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|