C18H18ClN2O5- — CID 9393558
3-[4-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate (PubChem CID 9393558) has the molecular formula C18H18ClN2O5- and a molecular weight of 377.80 g/mol. Its IUPAC name is 3-[4-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate.
| Compound Name | 3-[4-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
|---|---|
| PubChem CID | 9393558 |
| Molecular Formula | C18H18ClN2O5- |
| Molecular Weight | 377.80 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[4-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]-5-methylfuran-2-yl]propanoate |
| SMILES | C/C(=N/NC(=O)COc1ccc(Cl)cc1)c1cc(CCC(=O)[O-])oc1C |
| InChI | InChI=1S/C18H19ClN2O5/c1-11(16-9-15(26-12(16)2)7-8-18(23)24)20-21-17(22)10-25-14-5-3-13(19)4-6-14/h3-6,9H,7-8,10H2,1-2H3,(H,21,22)(H,23,24)/p-1/b20-11- |
| InChIKey | JXPCGBIRWUKZLB-JAIQZWGSSA-M |
| XLogP | 1.84 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.80 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|