C16H15Cl2NO3 — CID 24505751
3-(4-acetyl-5-methylfuran-2-yl)-N-(3,4-dichlorophenyl)propanamide (PubChem CID 24505751) has the molecular formula C16H15Cl2NO3 and a molecular weight of 340.21 g/mol. Its IUPAC name is 3-(4-acetyl-5-methylfuran-2-yl)-N-(3,4-dichlorophenyl)propanamide.
| Compound Name | 3-(4-acetyl-5-methylfuran-2-yl)-N-(3,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 24505751 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-(4-acetyl-5-methylfuran-2-yl)-N-(3,4-dichlorophenyl)propanamide |
| SMILES | CC(=O)c1cc(CCC(=O)Nc2ccc(Cl)c(Cl)c2)oc1C |
| InChI | InChI=1S/C16H15Cl2NO3/c1-9(20)13-8-12(22-10(13)2)4-6-16(21)19-11-3-5-14(17)15(18)7-11/h3,5,7-8H,4,6H2,1-2H3,(H,19,21) |
| InChIKey | VXADZMHWBWMTQI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |