C14H13Cl2NO2 — CID 26719667
N-(3,4-dichlorophenyl)-2,4,5-trimethylfuran-3-carboxamide (PubChem CID 26719667) has the molecular formula C14H13Cl2NO2 and a molecular weight of 298.17 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2,4,5-trimethylfuran-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-2,4,5-trimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 26719667 |
| Molecular Formula | C14H13Cl2NO2 |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2,4,5-trimethylfuran-3-carboxamide |
| SMILES | Cc1oc(C)c(C(=O)Nc2ccc(Cl)c(Cl)c2)c1C |
| InChI | InChI=1S/C14H13Cl2NO2/c1-7-8(2)19-9(3)13(7)14(18)17-10-4-5-11(15)12(16)6-10/h4-6H,1-3H3,(H,17,18) |
| InChIKey | CXVSNSRECJCBSG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |