C16H17NO4 — CID 26720131
methyl 4-[(2,4,5-trimethylfuran-3-carbonyl)amino]benzoate (PubChem CID 26720131) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is methyl 4-[(2,4,5-trimethylfuran-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(2,4,5-trimethylfuran-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 26720131 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | methyl 4-[(2,4,5-trimethylfuran-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2c(C)oc(C)c2C)cc1 |
| InChI | InChI=1S/C16H17NO4/c1-9-10(2)21-11(3)14(9)15(18)17-13-7-5-12(6-8-13)16(19)20-4/h5-8H,1-4H3,(H,17,18) |
| InChIKey | ZASMXOKOBKGZPN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |