C21H26F3NO3Si2 — CID 132529149
methyl 4-[[2,4,6-trifluoro-3,5-bis(trimethylsilyl)benzoyl]amino]benzoate (PubChem CID 132529149) has the molecular formula C21H26F3NO3Si2 and a molecular weight of 453.61 g/mol. Its IUPAC name is methyl 4-[[2,4,6-trifluoro-3,5-bis(trimethylsilyl)benzoyl]amino]benzoate.
| Compound Name | methyl 4-[[2,4,6-trifluoro-3,5-bis(trimethylsilyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 132529149 |
| Molecular Formula | C21H26F3NO3Si2 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | methyl 4-[[2,4,6-trifluoro-3,5-bis(trimethylsilyl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2c(F)c([Si](C)(C)C)c(F)c([Si](C)(C)C)c2F)cc1 |
| InChI | InChI=1S/C21H26F3NO3Si2/c1-28-21(27)12-8-10-13(11-9-12)25-20(26)14-15(22)18(29(2,3)4)17(24)19(16(14)23)30(5,6)7/h8-11H,1-7H3,(H,25,26) |
| InChIKey | JFBGJAWCLZOGTM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|