C16H15NO5 — CID 110699348
methyl 4-[(2,4-dimethyl-6-oxopyran-3-carbonyl)amino]benzoate (PubChem CID 110699348) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is methyl 4-[(2,4-dimethyl-6-oxopyran-3-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(2,4-dimethyl-6-oxopyran-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110699348 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | methyl 4-[(2,4-dimethyl-6-oxopyran-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2c(C)cc(=O)oc2C)cc1 |
| InChI | InChI=1S/C16H15NO5/c1-9-8-13(18)22-10(2)14(9)15(19)17-12-6-4-11(5-7-12)16(20)21-3/h4-8H,1-3H3,(H,17,19) |
| InChIKey | JEHGAUYCLVCSOF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |