C9H8Cl2N2O3 — CID 71381636
[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid (PubChem CID 71381636) has the molecular formula C9H8Cl2N2O3 and a molecular weight of 263.08 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid.
| Compound Name | [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 71381636 |
| Molecular Formula | C9H8Cl2N2O3 |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid |
| SMILES | O=C(O)NCC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O3/c10-6-2-1-5(3-7(6)11)13-8(14)4-12-9(15)16/h1-3,12H,4H2,(H,13,14)(H,15,16) |
| InChIKey | SAEYITBSOFMDAT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |