[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid

C9H8Cl2N2O3 — CID 71381636

IUPAC[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid
SMILESO=C(O)NCC(=O)Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C9H8Cl2N2O3/c10-6-2-1-5(3-7(6)11)13-8(14)4-12-9(15)16/h1-3,12H,4H2,(H,13,14)(H,15,16)
InChIKeySAEYITBSOFMDAT-UHFFFAOYSA-N
MW263.08 g/mol
LogP2.20
Rot. Bonds3

About [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid

[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid (PubChem CID 71381636) has the molecular formula C9H8Cl2N2O3 and a molecular weight of 263.08 g/mol. Its IUPAC name is [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid.

Molecular Properties

Compound Name[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid
PubChem CID71381636
Molecular FormulaC9H8Cl2N2O3
Molecular Weight263.08 g/mol
Exact Mass261.99
IUPAC Name[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid
SMILESO=C(O)NCC(=O)Nc1ccc(Cl)c(Cl)c1
InChIInChI=1S/C9H8Cl2N2O3/c10-6-2-1-5(3-7(6)11)13-8(14)4-12-9(15)16/h1-3,12H,4H2,(H,13,14)(H,15,16)
InChIKeySAEYITBSOFMDAT-UHFFFAOYSA-N
XLogP2.20
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.08
LogP ≤ 52.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid?
The IUPAC name of [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid (CID 71381636) is [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid.
What is the SMILES notation for [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid?
The canonical SMILES for [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid is O=C(O)NCC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid?
The InChIKey is SAEYITBSOFMDAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2N2O3/c10-6-2-1-5(3-7(6)11)13-8(14)4-12-9(15)16/h1-3,12H,4H2,(H,13,14)(H,15,16).
What are the key properties of [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid?
[2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid has a molecular weight of 263.08 g/mol, XLogP of 2.20, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dichloroanilino)-2-oxoethyl]carbamic acid is sourced from PubChem (CID 71381636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).