C15H11Cl3N2O2 — CID 9411490
2-chloro-N-[2-(3,4-dichloroanilino)-2-oxoethyl]benzamide (PubChem CID 9411490) has the molecular formula C15H11Cl3N2O2 and a molecular weight of 357.62 g/mol. Its IUPAC name is 2-chloro-N-[2-(3,4-dichloroanilino)-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-(3,4-dichloroanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9411490 |
| Molecular Formula | C15H11Cl3N2O2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | 2-chloro-N-[2-(3,4-dichloroanilino)-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2O2/c16-11-4-2-1-3-10(11)15(22)19-8-14(21)20-9-5-6-12(17)13(18)7-9/h1-7H,8H2,(H,19,22)(H,20,21) |
| InChIKey | BNSMEFHYNIFQPJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |