C15H10ClF2N2O2- — CID 8974207
4-chloro-3-[(2Z)-2-[1-(2,5-difluorophenyl)ethylidene]hydrazinyl]benzoate (PubChem CID 8974207) has the molecular formula C15H10ClF2N2O2- and a molecular weight of 323.71 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[1-(2,5-difluorophenyl)ethylidene]hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[(2Z)-2-[1-(2,5-difluorophenyl)ethylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 8974207 |
| Molecular Formula | C15H10ClF2N2O2- |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[1-(2,5-difluorophenyl)ethylidene]hydrazinyl]benzoate |
| SMILES | C/C(=N/Nc1cc(C(=O)[O-])ccc1Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H11ClF2N2O2/c1-8(11-7-10(17)3-5-13(11)18)19-20-14-6-9(15(21)22)2-4-12(14)16/h2-7,20H,1H3,(H,21,22)/p-1/b19-8- |
| InChIKey | GCGHSGDFBQSDLN-UWVJOHFNSA-M |
| XLogP | 2.82 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|