C11H12ClN2O2- — CID 8973555
3-[(2Z)-2-butan-2-ylidenehydrazinyl]-4-chlorobenzoate (PubChem CID 8973555) has the molecular formula C11H12ClN2O2- and a molecular weight of 239.68 g/mol. Its IUPAC name is 3-[(2Z)-2-butan-2-ylidenehydrazinyl]-4-chlorobenzoate.
| Compound Name | 3-[(2Z)-2-butan-2-ylidenehydrazinyl]-4-chlorobenzoate |
|---|---|
| PubChem CID | 8973555 |
| Molecular Formula | C11H12ClN2O2- |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 3-[(2Z)-2-butan-2-ylidenehydrazinyl]-4-chlorobenzoate |
| SMILES | CC/C(C)=N\Nc1cc(C(=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H13ClN2O2/c1-3-7(2)13-14-10-6-8(11(15)16)4-5-9(10)12/h4-6,14H,3H2,1-2H3,(H,15,16)/p-1/b13-7- |
| InChIKey | DGWPMBXUCYEOFV-QPEQYQDCSA-M |
| XLogP | 1.90 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|