C17H18ClN3O4S — CID 8973961
4-chloro-3-[(2Z)-2-[1-[4-(dimethylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid (PubChem CID 8973961) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[1-[4-(dimethylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2Z)-2-[1-[4-(dimethylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 8973961 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[1-[4-(dimethylsulfamoyl)phenyl]ethylidene]hydrazinyl]benzoic acid |
| SMILES | C/C(=N/Nc1cc(C(=O)O)ccc1Cl)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H18ClN3O4S/c1-11(12-4-7-14(8-5-12)26(24,25)21(2)3)19-20-16-10-13(17(22)23)6-9-15(16)18/h4-10,20H,1-3H3,(H,22,23)/b19-11- |
| InChIKey | BQKGDFBWOUCIMB-ODLFYWEKSA-N |
| XLogP | 3.12 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|