C17H20N4O3S — CID 9242121
1-[(Z)-1-[4-(dimethylsulfamoyl)phenyl]ethylideneamino]-3-phenylurea (PubChem CID 9242121) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-[(Z)-1-[4-(dimethylsulfamoyl)phenyl]ethylideneamino]-3-phenylurea.
| Compound Name | 1-[(Z)-1-[4-(dimethylsulfamoyl)phenyl]ethylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 9242121 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[(Z)-1-[4-(dimethylsulfamoyl)phenyl]ethylideneamino]-3-phenylurea |
| SMILES | C/C(=N/NC(=O)Nc1ccccc1)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H20N4O3S/c1-13(19-20-17(22)18-15-7-5-4-6-8-15)14-9-11-16(12-10-14)25(23,24)21(2)3/h4-12H,1-3H3,(H2,18,20,22)/b19-13- |
| InChIKey | JVXIPXGNPMTNKP-UYRXBGFRSA-N |
| XLogP | 2.48 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|