C21H26ClN3O3 — CID 8974024
4-chloro-3-[(2Z)-2-[1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylidene]hydrazinyl]benzoic acid (PubChem CID 8974024) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2Z)-2-[1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 8974024 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[1-[3-(diethylaminomethyl)-4-methoxyphenyl]ethylidene]hydrazinyl]benzoic acid |
| SMILES | CCN(CC)Cc1cc(/C(C)=N\Nc2cc(C(=O)O)ccc2Cl)ccc1OC |
| InChI | InChI=1S/C21H26ClN3O3/c1-5-25(6-2)13-17-11-15(8-10-20(17)28-4)14(3)23-24-19-12-16(21(26)27)7-9-18(19)22/h7-12,24H,5-6,13H2,1-4H3,(H,26,27)/b23-14- |
| InChIKey | NWSOSISCUXPVLH-UCQKPKSFSA-N |
| XLogP | 4.72 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|