C14H13ClN3O2- — CID 135846230
4-chloro-3-[(2E)-2-[(2,5-dimethyl-1H-pyrrol-3-yl)methylidene]hydrazinyl]benzoate (PubChem CID 135846230) has the molecular formula C14H13ClN3O2- and a molecular weight of 290.73 g/mol. Its IUPAC name is 4-chloro-3-[(2E)-2-[(2,5-dimethyl-1H-pyrrol-3-yl)methylidene]hydrazinyl]benzoate.
| Compound Name | 4-chloro-3-[(2E)-2-[(2,5-dimethyl-1H-pyrrol-3-yl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 135846230 |
| Molecular Formula | C14H13ClN3O2- |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-chloro-3-[(2E)-2-[(2,5-dimethyl-1H-pyrrol-3-yl)methylidene]hydrazinyl]benzoate |
| SMILES | Cc1cc(/C=N/Nc2cc(C(=O)[O-])ccc2Cl)c(C)[nH]1 |
| InChI | InChI=1S/C14H14ClN3O2/c1-8-5-11(9(2)17-8)7-16-18-13-6-10(14(19)20)3-4-12(13)15/h3-7,17-18H,1-2H3,(H,19,20)/p-1/b16-7+ |
| InChIKey | QVSSDSNQGJLXNQ-FRKPEAEDSA-M |
| XLogP | 2.09 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|