C14H10ClFN2O2 — CID 8973534
4-chloro-3-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 8973534) has the molecular formula C14H10ClFN2O2 and a molecular weight of 292.70 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 8973534 |
| Molecular Formula | C14H10ClFN2O2 |
| Molecular Weight | 292.70 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(N/N=C\c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C14H10ClFN2O2/c15-12-6-3-10(14(19)20)7-13(12)18-17-8-9-1-4-11(16)5-2-9/h1-8,18H,(H,19,20)/b17-8- |
| InChIKey | UFLVSRBNQHNHBJ-IUXPMGMMSA-N |
| XLogP | 3.62 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|