C20H22ClN3O5 — CID 8974126
4-chloro-3-[(2Z)-2-[[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 8974126) has the molecular formula C20H22ClN3O5 and a molecular weight of 419.87 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2Z)-2-[[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 8974126 |
| Molecular Formula | C20H22ClN3O5 |
| Molecular Weight | 419.87 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[[4-[2-(dimethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | CCOc1cc(/C=N\Nc2cc(C(=O)O)ccc2Cl)ccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C20H22ClN3O5/c1-4-28-18-9-13(5-8-17(18)29-12-19(25)24(2)3)11-22-23-16-10-14(20(26)27)6-7-15(16)21/h5-11,23H,4,12H2,1-3H3,(H,26,27)/b22-11- |
| InChIKey | XOLMBUBKGSKPOY-JJFYIABZSA-N |
| XLogP | 3.35 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.87 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|