C14H9Cl2FN2O2 — CID 8973526
4-chloro-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 8973526) has the molecular formula C14H9Cl2FN2O2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 4-chloro-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-chloro-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 8973526 |
| Molecular Formula | C14H9Cl2FN2O2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 4-chloro-3-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(N/N=C\c2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C14H9Cl2FN2O2/c15-10-2-1-3-12(17)9(10)7-18-19-13-6-8(14(20)21)4-5-11(13)16/h1-7,19H,(H,20,21)/b18-7- |
| InChIKey | DYMXKAHWVQQAMJ-WSVATBPTSA-N |
| XLogP | 4.28 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|