C14H9ClFN2O2- — CID 7066818
4-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoate (PubChem CID 7066818) has the molecular formula C14H9ClFN2O2- and a molecular weight of 291.69 g/mol. Its IUPAC name is 4-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoate.
| Compound Name | 4-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoate |
|---|---|
| PubChem CID | 7066818 |
| Molecular Formula | C14H9ClFN2O2- |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 4-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]benzoate |
| SMILES | O=C([O-])c1ccc(N/N=C\c2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C14H10ClFN2O2/c15-12-2-1-3-13(16)11(12)8-17-18-10-6-4-9(5-7-10)14(19)20/h1-8,18H,(H,19,20)/p-1/b17-8- |
| InChIKey | KKQXUBPTMRQPBW-IUXPMGMMSA-M |
| XLogP | 2.29 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|