C21H16ClFN2O — CID 4980565
N-[(2-chloro-6-fluorophenyl)methylideneamino]-2,2-diphenylacetamide (PubChem CID 4980565) has the molecular formula C21H16ClFN2O and a molecular weight of 366.82 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methylideneamino]-2,2-diphenylacetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 4980565 |
| Molecular Formula | C21H16ClFN2O |
| Molecular Weight | 366.82 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methylideneamino]-2,2-diphenylacetamide |
| SMILES | O=C(NN=Cc1c(F)cccc1Cl)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16ClFN2O/c22-18-12-7-13-19(23)17(18)14-24-25-21(26)20(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-14,20H,(H,25,26) |
| InChIKey | CEZUQYZFICHKGX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|