C13H15ClFN3O2 — CID 3130667
N'-[(2-chloro-6-fluorophenyl)methylideneamino]-N-propan-2-ylpropanediamide (PubChem CID 3130667) has the molecular formula C13H15ClFN3O2 and a molecular weight of 299.73 g/mol. Its IUPAC name is N'-[(2-chloro-6-fluorophenyl)methylideneamino]-N-propan-2-ylpropanediamide.
| Compound Name | N'-[(2-chloro-6-fluorophenyl)methylideneamino]-N-propan-2-ylpropanediamide |
|---|---|
| PubChem CID | 3130667 |
| Molecular Formula | C13H15ClFN3O2 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N'-[(2-chloro-6-fluorophenyl)methylideneamino]-N-propan-2-ylpropanediamide |
| SMILES | CC(C)NC(=O)CC(=O)NN=Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C13H15ClFN3O2/c1-8(2)17-12(19)6-13(20)18-16-7-9-10(14)4-3-5-11(9)15/h3-5,7-8H,6H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | XZDBASOKWJYPSR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|