C18H19ClFN3O3S — CID 92661070
N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide (PubChem CID 92661070) has the molecular formula C18H19ClFN3O3S and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 92661070 |
| Molecular Formula | C18H19ClFN3O3S |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[(Z)-(2-chloro-6-fluorophenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide |
| SMILES | Cc1cccc(C)c1N(CC(=O)N/N=C\c1c(F)cccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C18H19ClFN3O3S/c1-12-6-4-7-13(2)18(12)23(27(3,25)26)11-17(24)22-21-10-14-15(19)8-5-9-16(14)20/h4-10H,11H2,1-3H3,(H,22,24)/b21-10- |
| InChIKey | RPOKEWBJYZBMAM-FBHDLOMBSA-N |
| XLogP | 3.01 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|