C17H9ClFN2O3- — CID 2556832
4-[[(E)-3-(2-chloro-6-fluorophenyl)-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 2556832) has the molecular formula C17H9ClFN2O3- and a molecular weight of 343.72 g/mol. Its IUPAC name is 4-[[(E)-3-(2-chloro-6-fluorophenyl)-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | 4-[[(E)-3-(2-chloro-6-fluorophenyl)-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2556832 |
| Molecular Formula | C17H9ClFN2O3- |
| Molecular Weight | 343.72 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 4-[[(E)-3-(2-chloro-6-fluorophenyl)-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | N#C/C(=C\c1c(F)cccc1Cl)C(=O)Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C17H10ClFN2O3/c18-14-2-1-3-15(19)13(14)8-11(9-20)16(22)21-12-6-4-10(5-7-12)17(23)24/h1-8H,(H,21,22)(H,23,24)/p-1/b11-8+ |
| InChIKey | JQKMKHJWAJSCDS-DHZHZOJOSA-M |
| XLogP | 2.39 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|